Content deleted Content added
Citation bot (talk | contribs) m Add: year, pages, issue, volume, journal, title, pmid, author pars. 1-6. You can use this bot yourself. Report bugs here. |
Citation bot (talk | contribs) Added bibcode. | Use this bot. Report bugs. | Suggested by Superegz | Category:O-methylated isoflavones | #UCB_Category 8/16 |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 4:
| verifiedrevid = 477376646
| Name = Calycosin
| ImageFile = Calycosin.
| ImageSize = 220px
| ImageName = Chemical structure of calycosin
Line 10:
| ImageSize1 = 220
| ImageAlt1 = Calycosin molecule
| IUPACName = 3′,7-
| SystematicName = 7-Hydroxy-3-(3-hydroxy-4-methoxyphenyl)-4''H''-1-benzopyran-4-one
| OtherNames = 7,
|Section1={{Chembox Identifiers
| CASNo = 20575-57-9
| CASNo_Ref = {{cascite|changed|??}}
| CASNoOther =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
Line 26 ⟶ 27:
| ChemSpiderID = 4444104
| SMILES = O=C\1c3c(O/C=C/1c2ccc(OC)c(O)c2)cc(O)cc3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H12O5/c1-20-14-5-2-9(6-13(14)18)12-8-21-15-7-10(17)3-4-11(15)16(12)19/h2-8,17-18H,1H3
Line 45 ⟶ 44:
}}
}}
'''Calycosin''' is an [[O-methylated isoflavone|''O''-methylated isoflavone]]. It can be isolated from ''[[Astragalus membranaceus]]'' Bge. var. ''mongholicus''<ref>{{Cite journal | doi = 10.1016/S0021-9673(02)00535-6| pmid = 12198969| title = Preparative isolation and purification of calycosin from ''Astragalus membranaceus'' Bge.
== Biosynthesis ==
[[Isoflavone 3'-hydroxylase|Isoflavone 3′-hydroxylase]] uses [[formononetin]], NADPH, H<sup>+</sup> and O<sub>2</sub> to produce calycosin, NADP<sup>+</sup> and H<sub>2</sub>O.
== References ==
Line 55 ⟶ 54:
{{isoflavone}}
[[Category:O-
{{phenol-stub}}
|