Jump to content

4,5-MDO-DiPT: Difference between revisions

From Wikipedia, the free encyclopedia
Browse history interactively
← Previous edit
Content deleted Content added
VisualWikitext
→Categorization: unnecessary
Importing Wikidata short description: "Chemical compound"
 
(16 intermediate revisions by 14 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{chembox
{{Infobox drug
| verifiedrevid = 455012632
| ImageFile = 4,5-MDO-DiPT.svg
| drug_name = 4,5-MDO-DiPT
| image = 4,5-MDO-DiPT.svg
| ImageSize = 200px
| IUPACName =
| width =
| caption =
⚫
| OtherNames = 4,5-methylenedioxy-N,N-diisopropyltryptamine

| Section1 = {{Chembox Identifiers
<!-- Clinical data -->
⚫
| CASNo_Ref = {{cascite|correct|??}}
| CASNo =
| pronounce =
| PubChem =
| tradename =
| SMILES = }}
| Drugs.com =
| MedlinePlus =
| Section2 = {{Chembox Properties
| licence_CA =
| Formula = C<sub>17</sub>H<sub>24</sub>N<sub>2</sub>O<sub>2</sub>
| licence_EU =
| MolarMass = 288.39 g/mol
| Appearance =
| DailyMedID =
| Density =
| licence_US =
| MeltingPt =
| pregnancy_AU =
| BoilingPt =
| pregnancy_category =
| dependency_liability =
| Solubility = }}
| addiction_liability =
| Section3 = {{Chembox Hazards
| routes_of_administration =
| MainHazards =
| FlashPt =
| class =
| Autoignition = }}
| ATC_prefix =
| ATC_suffix =

<!-- Legal status -->
| legal_status =

<!-- Pharmacokinetic data -->
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =

<!-- Identifiers -->
| CAS_number = 82173-82-8
| CAS_supplemental =
⚫
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = VTE2RS8757
| PubChem = 44383444
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID = 23511907
| KEGG =
| ChEBI =
| ChEMBL = 352315
| NIAID_ChemDB =
| PDB_ligand =
⚫
| synonyms = 4,5-Methylenedioxy-N,N-diisopropyltryptamine

<!-- Chemical data -->
| IUPAC_name = N-[2-(6H-[1,3]dioxolo[4,5-e]indol-8-yl)ethyl]-N-propan-2-ylpropan-2-amine
| C=17 | H=24 | N=2 | O=2
| SMILES = CC(C)N(CCC1=CNC2=C1C3=C(C=C2)OCO3)C(C)C
| StdInChI = 1S/C17H24N2O2/c1-11(2)19(12(3)4)8-7-13-9-18-14-5-6-15-17(16(13)14)21-10-20-15/h5-6,9,11-12,18H,7-8,10H2,1-4H3
| StdInChIKey = PTYYWSKZYOSFEK-UHFFFAOYSA-N
}}
}}


'''4,5-MDO-DiPT''', or '''4,5-[[methylenedioxy]]-N,N-di[[isopropyl]][[tryptamine]]''', is a lesser-known [[Psychedelics, dissociatives and deliriants|psychedelic drug]]. It is the 4,5-[[methylene]]di[[oxy]] [[analog (chemistry)|analog]] of [[DiPT]]. 4,5-MDO-DiPT was first synthesized by [[Alexander Shulgin]]. In his book ''[[TiHKAL]]'' (''Tryptamines I Have Known and Loved''), 4,5-MDO-DiPT produces slight [[LSD]]-like effects after several hours. Very little data exists about the pharmacological properties, metabolism, and toxicity of 4,5-MDO-DiPT.
'''4,5-MDO-DiPT''', or '''4,5-[[methylenedioxy]]-N,N-di[[isopropyl]][[tryptamine]]''', is a lesser-known [[Psychedelics, dissociatives and deliriants|psychedelic drug]]. It is the 4,5-[[methylene bridge|methylene]]di[[Oxygen|oxy]] [[analog (chemistry)|analog]] of [[DiPT]]. 4,5-MDO-DiPT was first synthesized by [[Alexander Shulgin]]. In his book ''[[TiHKAL]]'' (''Tryptamines I Have Known and Loved''), 4,5-MDO-DiPT produces slight [[LSD]]-like effects after several hours. Very little data exists about the pharmacological properties, metabolism, and toxicity of 4,5-MDO-DiPT.


== See also ==
== See also ==
* [[1-(2-Dimethylaminoethyl)dihydropyrano(3,2-e)indole|4,5-DHP-DMT]]
* [[1-(2-Dimethylaminoethyl)dihydropyrano(3,2-e)indole|4,5-DHP-DMT]]
* [[4,5-MDO-DMT]]
* [[4,5-MDO-DMT]]
* [[5,6-MDO-DiPT]]
* [[Tryptamine]]
* [[Tryptamine]]
* [[DiPT]]
* [[DiPT]]
Line 37: Line 75:
* [http://tihkal.info/read.php?domain=tk&id=28 4,5-MDO-DIPT Entry in TiHKAL • info]
* [http://tihkal.info/read.php?domain=tk&id=28 4,5-MDO-DIPT Entry in TiHKAL • info]


{{TiHKAL}}
{{Tryptamines}}


[[Category:Psychedelic tryptamines]]
[[Category:Psychedelic tryptamines]]
[[Category:Diisopropylamino compounds]]




{{Psychoactive-stub}}
{{Psychoactive-stub}}

[[fa:۴،۵-ام‌دی‌او-دی‌پی‌تی]]

Latest revision as of 00:26, 25 January 2023

4,5-MDO-DiPT
Clinical data
Other names4,5-Methylenedioxy-N,N-diisopropyltryptamine
Identifiers
  • N-[2-(6H-[1,3]dioxolo[4,5-e]indol-8-yl)ethyl]-N-propan-2-ylpropan-2-amine
CAS Number
PubChem CID
ChemSpider
UNII
ChEMBL
CompTox Dashboard (EPA)
Chemical and physical data
FormulaC17H24N2O2
Molar mass288.391 g·mol−1
3D model (JSmol)
  • CC(C)N(CCC1=CNC2=C1C3=C(C=C2)OCO3)C(C)C
  • InChI=1S/C17H24N2O2/c1-11(2)19(12(3)4)8-7-13-9-18-14-5-6-15-17(16(13)14)21-10-20-15/h5-6,9,11-12,18H,7-8,10H2,1-4H3
  • Key:PTYYWSKZYOSFEK-UHFFFAOYSA-N

4,5-MDO-DiPT, or 4,5-methylenedioxy-N,N-diisopropyltryptamine, is a lesser-known psychedelic drug. It is the 4,5-methylenedioxy analog of DiPT. 4,5-MDO-DiPT was first synthesized by Alexander Shulgin. In his book TiHKAL (Tryptamines I Have Known and Loved), 4,5-MDO-DiPT produces slight LSD-like effects after several hours. Very little data exists about the pharmacological properties, metabolism, and toxicity of 4,5-MDO-DiPT.

See also

[edit]
[edit]


Stub icon

This psychoactive drug-related article is a stub. You can help Wikipedia by expanding it.

Retrieved from "https://en.wikipedia.org/w/index.php?title=4,5-MDO-DiPT&oldid=1135493866"