Batyl alcohol: Difference between revisions
added Category:Glycerol ethers using HotCat |
more ids |
||
| Line 1: | Line 1: | ||
{{Chembox |
{{Chembox |
||
| ImageFile = S-batylic alcohol.svg |
| ImageFile = S-batylic alcohol.svg |
||
| ImageCaption = S-enantiomer |
|||
| ImageSize = |
| ImageSize = |
||
| ImageAlt = |
| ImageAlt = |
||
| IUPACName = |
| IUPACName = 3-octadecoxypropane-1,2-diol |
||
| OtherNames = batylic alcohol, batilol, 1-O-octadecylglycerol, stearyl monoglyceride |
| OtherNames = batylic alcohol, batilol, 1-O-octadecylglycerol, stearyl monoglyceride |
||
|Section1={{Chembox Identifiers |
|Section1={{Chembox Identifiers |
||
| CASNo = 544-62-7 |
| CASNo = 544-62-7 |
||
| CASNo_Ref = {{Cascite|correct|CAS}} |
|||
| CASNo_Comment = racemic |
| CASNo_Comment = racemic |
||
| CASNo1 = 6129-13-1 |
| CASNo1 = 6129-13-1 |
||
| CASNo1_Comment = S-enantiomer |
| CASNo1_Comment = S-enantiomer |
||
| Beilstein = 1725677 |
|||
| ChEBI = 34117 |
|||
| ChEMBL = 1482516 |
|||
| ChemSpiderID = 3553 |
|||
| EC_number = 208-874-7 |
|||
| KEGG = C13858 |
|||
| PubChem = 3681 |
| PubChem = 3681 |
||
| |
| UNII = 39YR661C4U |
||
| StdInChI=1S/C21H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-20-21(23)19-22/h21-23H,2-20H2,1H3 |
|||
| StdInChIKey = OGBUMNBNEWYMNJ-UHFFFAOYSA-N |
|||
| SMILES = CCCCCCCCCCCCCCCCCCOCC(CO)O |
|||
}} |
|||
|Section2={{Chembox Properties |
|Section2={{Chembox Properties |
||
| C=21|H=44|O=3 |
| C=21|H=44|O=3 |
||
| Line 21: | Line 33: | ||
| BoilingPtC = 215-220 |
| BoilingPtC = 215-220 |
||
| BoilingPt_notes = 2 mm |
| BoilingPt_notes = 2 mm |
||
| Solubility = |
| Solubility = |
||
}} |
|||
|Section3={{Chembox Hazards |
|Section3={{Chembox Hazards |
||
| MainHazards = |
| MainHazards = |
||
| FlashPt = |
| FlashPt = |
||
| AutoignitionPt = |
| AutoignitionPt = |
||
}} |
|||
}} |
}} |
||
Revision as of 23:40, 9 January 2024
 S-enantiomer
| |
| Names | |
|---|---|
| IUPAC name
3-octadecoxypropane-1,2-diol
| |
| Other names
batylic alcohol, batilol, 1-O-octadecylglycerol, stearyl monoglyceride
| |
| Identifiers | |
3D model (JSmol)
|
|
| 1725677 | |
| ChEBI | |
| ChEMBL | |
| ChemSpider | |
| ECHA InfoCard | 100.008.068 |
| EC Number |
|
| KEGG | |
PubChem CID
|
|
| UNII | |
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C21H44O3 | |
| Molar mass | 344.580 g·mol−1 |
| Appearance | colorless solid |
| Melting point | 70.5 °C (158.9 °F; 343.6 K) |
| Boiling point | 215–220 °C (419–428 °F; 488–493 K) 2 mm |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Batyl alcohol is an organic compound with the formula HOCH2CH(OH)CH2OC18H37. It is a colorless solid. Batyl alcohol is a monoether formed by condensation of stearyl alcohol with one of the two primary alcohol sites of glycerol. Together with S-selachyl alcohol and S-chimyl alcohol, S-batyl alcohol is a component of some lipid membranes.[1]
Occurrence and metabolism
It is found in the liver of the shark Centrophorus squamosus.[2] The name batyl is derived from a classification of rays, order Batoidea. Like other glyceryl ethers, those derived from batyl alcohol are not saponifiable.[3]
Batyl alcohol and related glycyl ethers are susceptible to oxidation catalyzed by glyceryl-ether monooxygenases. The net oxidation gives glycerol and the carboxylic acid:
- HOCH2CH(OH)CH2OC18H37 + 1.5 O2 → HOCH2CH(OH)CH2OH + HO2CHC17H35 + H2O
Batyl alcohol and related glycyl ethers are also susceptible to dehydrogenation catalyzed unsaturases to give the vinyl ethers called plasmalogens:[3]
- HOCH2CH(OH)CH2OC18H37 + [O] → HOCH2CH(OH)CH2OCH=CHC16H35 + H2O
References
- ^ Sutter, Marc; Silva, Eric Da; Duguet, Nicolas; Raoul, Yann; Métay, Estelle; Lemaire, Marc (2015). "Glycerol Ether Synthesis: A Bench Test for Green Chemistry Concepts and Technologies" (PDF). Chemical Reviews. 115 (16): 8609–8651. doi:10.1021/cr5004002. PMID 26196761.
- ^ Bordier, Catherine G.; Sellier, Nicole; Foucault, Alain P.; Le Goffic, François (1996). "Purification and characterization of deep sea shark Centrophorus squamosus liver oil 1- O -aklylglycerol ether lipids". Lipids. 31 (5): 521–528. doi:10.1007/bf02522646. PMID 8727645. S2CID 39937991.
- ^ a b Taguchi, Hiroyasu; Armarego, Wilfred L. F. (1998). "Glyceryl-Ether Monooxygenase [EC 1.14.16.5]. A Microsomal Enzyme of Ether Lipid Metabolism". Medicinal Research Reviews. 18 (1): 43–89. doi:10.1002/(SICI)1098-1128(199801)18:1<43::AID-MED3>3.0.CO;2-S. PMID 9436181. S2CID 432376.