Jump to content

Phosacetim: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{chembox}} (changes to verified fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (rep
 
(24 intermediate revisions by 19 users not shown)
Line 1: Line 1:
{{chembox
{{Chembox
| Verifiedfields = changed
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 414881739
| verifiedrevid = 432322158
|ImageFile=Phosacetim.png
| ImageFile = Phosacetim Structure.svg
|ImageSize=
| ImageSize =
|IUPACName=N'-[Bis(4-chlorophenoxy)phosphorothioyl]ethanimidamide
| ImageFile1 = Phosacetim-3D-spacefill.png
|OtherNames=
| ImageSize1 = 240
| IUPACName = N'-[Bis(4-chlorophenoxy)phosphorothioyl]ethanimidamide
| OtherNames =
|Section1={{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo=4104-14-7
| CASNo = 4104-14-7
| PubChem=9570168
| KEGG_Ref = {{keggcite|changed|kegg}}| KEGG = C19140
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7B08Z34L7O
| SMILES=C/C(=N\P(=S)(OC1=CC=C(C=C1)Cl)OC2=CC=C(C=C2)Cl)N
| PubChem = 9570168
}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C19140
| SMILES = C/C(=N\P(=S)(OC1=CC=C(C=C1)Cl)OC2=CC=C(C=C2)Cl)N
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 7844636
| InChI = 1/C14H13Cl2N2O2PS/c1-10(17)18-21(22,19-13-6-2-11(15)3-7-13)20-14-8-4-12(16)5-9-14/h2-9H,1H3,(H2,17,18,22)
| InChIKey = XIBXUAZIZXDFTG-UHFFFAOYAC
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C14H13Cl2N2O2PS/c1-10(17)18-21(22,19-13-6-2-11(15)3-7-13)20-14-8-4-12(16)5-9-14/h2-9H,1H3,(H2,17,18,22)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = XIBXUAZIZXDFTG-UHFFFAOYSA-N
| RTECS =
| MeSHName =
| ChEBI =
}}
|Section2={{Chembox Properties
|Section2={{Chembox Properties
| Formula=C<sub>14</sub>H<sub>13</sub>Cl<sub>2</sub>N<sub>2</sub>O<sub>2</sub>PS
| Formula = C<sub>14</sub>H<sub>13</sub>Cl<sub>2</sub>N<sub>2</sub>O<sub>2</sub>PS
| MolarMass=375.210
| MolarMass = 375.210
| Appearance=
| Appearance =
| Density=
| Density =
| MeltingPt=
| MeltingPt =
| BoilingPt=
| BoilingPt =
| Solubility=
| Solubility =
}}
}}
|Section3={{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards=Toxic
| MainHazards = Toxic
| FlashPt=
| FlashPt =
| AutoignitionPt =
| Autoignition=
}}
}}
}}
}}
'''Phosacetim''' is a toxic [[organophosphate]] compound which acts as an [[acetylcholinesterase inhibitor]] and is used as a [[rodenticide]].


'''Phosacetim''' is a [[toxic]] [[organophosphate]] [[chemical compound|compound]], which acts as an [[acetylcholinesterase inhibitor]] and is used as a [[rodenticide]].<ref>{{Cite book |last=Tajti |first=Ádám |url=https://www.degruyter.com/document/doi/10.1515/9783110535839-003/html?lang=en |title=3. The importance of organophosphorus compounds as biologically active agents |last2=Keglevich |first2=György |date=2018-04-09 |publisher=De Gruyter |isbn=978-3-11-053583-9 |pages=63 |language=en |doi=10.1515/9783110535839-003/html?lang=en}}</ref>
{{rodenticides}}


==References==
{{Reflist}}


{{Rodenticides}}
{{Acetylcholine metabolism and transport modulators}}

[[Category:Acetylcholinesterase inhibitors]]
[[Category:Rodenticides]]
[[Category:Rodenticides]]
[[Category:Anticholinesterases]]
[[Category:4-Chlorophenyl compounds]]
[[Category:Organochlorides]]
[[Category:Phosphoramidothioates]]
[[Category:Phosphoramidothioates]]
[[Category:Phenol ethers]]
[[Category:Phenol ethers]]
[[Category:Amidines]]
[[Category:Amidines]]


{{organic-compound-stub}}

{{chemistry-stub}}